Systematic / IUPAC Name: 4-[(2-Fluorophenyl)amino]-4-oxobutanoic acid
ID: Reference6485
Other Names:
3-[N-(2-Fluorophenyl)carbamoyl]propanoic acid;
4-[(2-Fluorophenyl)amino]-4-oxobutanoic acid ;
Butanoic acid, 4-[(2-fluorophenyl)amino]-4-oxo-
Formula: C10H10FNO3
4-(2-Fluoroanilino)-4-oxobutanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/17/2017 1:38:40 PM |
| InChI | InChI=1S/C10H10FNO3/c11-7-3-1-2-4-8(7)12-9(13)5-6-10(14)15/h1-4H,5-6H2,(H,12,13)(H,14,15) |
| InChI Key | UWBFZPLATNJACG-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)NC(=O)CCC(=O)O)F |
| CAS | |
| Splash | |
| Other Names |
3-[N-(2-Fluorophenyl)carbamoyl]propanoic acid; 4-[(2-Fluorophenyl)amino]-4-oxobutanoic acid ; Butanoic acid, 4-[(2-fluorophenyl)amino]-4-oxo- |