Systematic / IUPAC Name: 3-Chloro-N-{[1-(dimethylamino)cyclohexyl]methyl}benzamide
ID: Reference6505
Other Names: Benzamide, 3-chloro-N-{[1-(dimethylamino)cyclohexyl]methyl}-
Formula: C16H23ClN2O
Class: Drugs of Abuse/Illegal Drugs
AH 8532 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/24/2017 6:45:32 AM |
| InChI | InChI=1S/C16H23ClN2O/c1-19(2)16(9-4-3-5-10-16)12-18-15(20)13-7-6-8-14(17)11-13/h6-8,11H,3-5,9-10,12H2,1-2H3,(H,18,20) |
| InChI Key | JFSYYIJPVLTYHL-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C1(CCCCC1)CNC(=O)C2=CC(=CC=C2)Cl |
| CAS | 786581553 |
| Splash | |
| Other Names | Benzamide, 3-chloro-N-{[1-(dimethylamino)cyclohexyl]methyl}- |
| PubChem | 16015605 |
| ChemSpider | 12262153 |
| ChEMBL | CHEMBL1317355 |