Systematic / IUPAC Name: [2-(4-Chlorophenoxy)-3-pyridinyl][4-(9H-fluoren-9-yl)-1-piperazinyl]methanone
ID: Reference6512
Other Names: Methanone, [2-(4-chlorophenoxy)-3-pyridinyl][4-(9H-fluoren-9-yl)-1-piperazinyl]-
Formula: C29H24ClN3O2
[2-(4-Chlorophenoxy)-3-pyridinyl][4-(9H-fluoren-9-yl)piperazino]methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 910 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 3/24/2017 1:05:40 PM |
| InChI | InChI=1S/C29H24ClN3O2/c30-20-11-13-21(14-12-20)35-28-26(10-5-15-31-28)29(34)33-18-16-32(17-19-33)27-24-8-3-1-6-22(24)23-7-2-4-9-25(23)27/h1-15,27H,16-19H2 |
| InChI Key | USLAOVBMUVVQCL-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN1C2C3=CC=CC=C3C4=CC=CC=C24)C(=O)C5=C(N=CC=C5)OC6=CC=C(C=C6)Cl |
| CAS | |
| Splash | |
| Other Names | Methanone, [2-(4-chlorophenoxy)-3-pyridinyl][4-(9H-fluoren-9-yl)-1-piperazinyl]- |