Systematic / IUPAC Name: Ethyl 3-[(2-carbamoyl-3-thienyl)amino]-3-oxopropanoate
ID: Reference6520
Other Names: Propanoic acid, 3-{[2-(aminocarbonyl)-3-thienyl]amino}-3-oxo-, ethyl ester
Formula: C10H12N2O4S
Ethyl 3-{[2-(aminocarbonyl)-3-thienyl]amino}-3-oxopropanoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1289 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 3/29/2017 1:27:28 PM |
| InChI | InChI=1S/C10H12N2O4S/c1-2-16-8(14)5-7(13)12-6-3-4-17-9(6)10(11)15/h3-4H,2,5H2,1H3,(H2,11,15)(H,12,13) |
| InChI Key | CEGHYOICLJCRTK-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)CC(=O)NC1=C(SC=C1)C(=O)N |
| CAS | |
| Splash | |
| Other Names | Propanoic acid, 3-{[2-(aminocarbonyl)-3-thienyl]amino}-3-oxo-, ethyl ester |
| PubChem | 2807693 |
| ChemSpider | 2086139 |
| ChEMBL | CHEMBL1351853 |