Systematic / IUPAC Name: N-(6-Chloro-1,3-benzothiazol-2-yl)-3,5-dimethyl-1,2-oxazole-4-carboxamide
ID: Reference6525
Other Names:
(3,5-Dimethylisoxazol-4-yl)-N-(6-chlorobenzothiazol-2-yl)carboxamide;
4-Isoxazolecarboxamide, N-(6-chloro-2-benzothiazolyl)-3,5-dimethyl-
Formula: C13H10ClN3O2S
N-(6-Chloro-1,3-benzothiazol-2-yl)-3,5-dimethyl-4-isoxazolecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 827 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 3/31/2017 8:23:15 AM |
| InChI | InChI=1S/C13H10ClN3O2S/c1-6-11(7(2)19-17-6)12(18)16-13-15-9-4-3-8(14)5-10(9)20-13/h3-5H,1-2H3,(H,15,16,18) |
| InChI Key | FEKIERSZUXSGNB-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C)C(=O)NC2=NC3=C(S2)C=C(C=C3)Cl |
| CAS | |
| Splash | |
| Other Names |
(3,5-Dimethylisoxazol-4-yl)-N-(6-chlorobenzothiazol-2-yl)carboxamide; 4-Isoxazolecarboxamide, N-(6-chloro-2-benzothiazolyl)-3,5-dimethyl- |
| PubChem | 2814505 |
| ChemSpider | 2092894 |
| ChEMBL | CHEMBL1299411 |