Systematic / IUPAC Name: 1-Butyl-5-(3,4-dichlorophenyl)-4-hydroxy-3-[5-(2-methyl-2-propanyl)-1,3,4-thiadiazol-2-yl]-2-imidazolidinone
ID: Reference6528
Other Names:
1-Butyl-3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-5-(3,4-dichlorophenyl)-4-hydroxyimidazolidin-2-one;
2-Imidazolidinone, 1-butyl-5-(3,4-dichlorophenyl)-3-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-4-hydroxy-
Formula: C19H24Cl2N4O2S
1-Butyl-3-[5-(tert-butyl)-1,3,4-thiadiazol-2-yl]-5-(3,4-dichlorophenyl)-4-hydroxyimidazolidin-2-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1837 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6, MS7 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/3/2017 8:10:46 AM |
| InChI | InChI=1S/C19H24Cl2N4O2S/c1-5-6-9-24-14(11-7-8-12(20)13(21)10-11)15(26)25(18(24)27)17-23-22-16(28-17)19(2,3)4/h7-8,10,14-15,26H,5-6,9H2,1-4H3 |
| InChI Key | IGSHLLPBVDNSOO-UHFFFAOYSA-N |
| Canonical SMILES | CCCCN1C(C(N(C1=O)C2=NN=C(S2)C(C)(C)C)O)C3=CC(=C(C=C3)Cl)Cl |
| CAS | |
| Splash | |
| Other Names |
1-Butyl-3-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-5-(3,4-dichlorophenyl)-4-hydroxyimidazolidin-2-one; 2-Imidazolidinone, 1-butyl-5-(3,4-dichlorophenyl)-3-[5-(1,1-dimethylethyl)-1,3,4-thiadiazol-2-yl]-4-hydroxy- |