Systematic / IUPAC Name: 5-Methyl-N-(3-pyridinylmethyl)-1,2-oxazol-3-amine
ID: Reference6532
Other Names: 3-Pyridinemethanamine, N-(5-methyl-3-isoxazolyl)-
Formula: C10H11N3O
5-Methyl-N-(pyridin-3-ylmethyl)isoxazol-3-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 730 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 4/4/2017 9:57:11 AM |
| InChI | InChI=1S/C10H11N3O/c1-8-5-10(13-14-8)12-7-9-3-2-4-11-6-9/h2-6H,7H2,1H3,(H,12,13) |
| InChI Key | YCTIWOKDBYCFJC-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=NO1)NCC2=CN=CC=C2 |
| CAS | |
| Splash | |
| Other Names | 3-Pyridinemethanamine, N-(5-methyl-3-isoxazolyl)- |
| ChemSpider | 2008752 |
| PubChem | 2726694 |
| ChEMBL | CHEMBL1565807 |