Systematic / IUPAC Name: N-[(4-Benzyl-2-morpholinyl)methyl]-6-(4-morpholinyl)nicotinamide
ID: Reference6533
Other Names: 3-Pyridinecarboxamide, 6-(4-morpholinyl)-N-{[4-(phenylmethyl)-2-morpholinyl]methyl}-
Formula: C22H28N4O3
N-[(4-Benzyl-1,4-oxazinan-2-yl)methyl]-6-morpholinonicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 409 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 4/4/2017 11:29:10 AM |
| InChI | InChI=1S/C22H28N4O3/c27-22(19-6-7-21(23-14-19)26-9-11-28-12-10-26)24-15-20-17-25(8-13-29-20)16-18-4-2-1-3-5-18/h1-7,14,20H,8-13,15-17H2,(H,24,27) |
| InChI Key | YPPOMKOXHOQTCK-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCN1C2=NC=C(C=C2)C(=O)NCC3CN(CCO3)CC4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | 3-Pyridinecarboxamide, 6-(4-morpholinyl)-N-{[4-(phenylmethyl)-2-morpholinyl]methyl}- |