Systematic / IUPAC Name: 3-(2-Chlorophenyl)-5-methyl-N-({3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)-1,2-oxazole-4-carboxamide
ID: Reference6544
Other Names: 4-Isoxazolecarboxamide, 3-(2-chlorophenyl)-5-methyl-N-({3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)-
Formula: C21H14ClF3N4O3
3-(2-Chlorophenyl)-5-methyl-N-({3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)isoxazole-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 785 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | IT; FT |
| Last Modification | 4/7/2017 11:50:41 AM |
| InChI | InChI=1S/C21H14ClF3N4O3/c1-11-17(18(28-31-11)14-4-2-3-5-15(14)22)20(30)26-10-16-27-19(29-32-16)12-6-8-13(9-7-12)21(23,24)25/h2-9H,10H2,1H3,(H,26,30) |
| InChI Key | YCRGINBWVQHNRF-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2Cl)C(=O)NCC3=NC(=NO3)C4=CC=C(C=C4)C(F)(F)F |
| CAS | |
| Splash | |
| Other Names | 4-Isoxazolecarboxamide, 3-(2-chlorophenyl)-5-methyl-N-({3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)- |
| ChemSpider | 2087891 |
| PubChem | 2809469 |
| ChEMBL | CHEMBL1341334 |