Systematic / IUPAC Name: Methyl cinnamate
ID: Reference6564
Other Names:
Semasorb 9815;
(E)-3-Phenylacrylic acid methyl ester;
(E)-Methyl cinnamate;
(2E)-3-Phenyl-2-propenoic acid methyl ester;
trans-3-Phenylacrylic acid methyl ester
; more
Formula: C10H10O2
Class: Endogenous Metabolites Excipients/Additives/Colorants Personal Care Products/Cosmetics
Methyl cinnamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 540 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/18/2017 8:23:53 AM |
| InChI | InChI=1S/C10H10O2/c1-12-10(11)8-7-9-5-3-2-4-6-9/h2-8H,1H3/b8-7+ |
| InChI Key | CCRCUPLGCSFEDV-BQYQJAHWSA-N |
| Canonical SMILES | COC(=O)C=CC1=CC=CC=C1 |
| CAS | 103264 |
| Splash | |
| Other Names |
Semasorb 9815; (E)-3-Phenylacrylic acid methyl ester; (E)-Methyl cinnamate; (2E)-3-Phenyl-2-propenoic acid methyl ester; trans-3-Phenylacrylic acid methyl ester; trans-Cinnamic acid methyl ester; trans-Methyl 3-phenyl-2-propenoate; trans-Methyl cinnamate; 2-Propenoic acid, 3-phenyl-, methyl ester, (E)-; 2-Propenoic acid, 3-phenyl-, methyl ester, (2E)-; 3-Phenyl-2-propenoic acid methyl; 3-Phenyl-2-propenoic acid methyl ester; Cinnamic acid methyl ester; Cinnamic acid, methyl ester; Cinnamic acid, methyl ester, (E)-; Methyl (E)-3-phenyl-2-propenoate; Methyl (E)-3-phenylprop-2-enoate; Methyl (E)-3-phenylpropenoate; Methyl (E)-cinnamate; Methyl (2E)-3-phenylacrylate; Methyl (2E)-3-phenylprop-2-enoate; Methyl trans-3-phenyl-2-propenoate; Methyl trans-cinnamate; Methyl 3-phenyl-2-propenoate; Methyl 3-phenylpropenoate; Methyl cinnamate, (E); Methyl cinnamylate; Methyl-3 phenylprop-2-enoate; Methylcinnamate |
| KEGG | C06358 |
| Wikipedia | Methyl cinnamate |
| PubChem | 637520 |
| ChEMBL | CHEMBL55060 |
| ChemSpider | 21105944 |
| ChEBI | CHEBI:6857 |