Systematic / IUPAC Name: 4-(Hydroxymethyl)-2-methoxyphenol
ID: Reference6572
Other Names:
Vanillic alcohol;
Vanillin alcohol;
Vanillol;
3-Methoxy-4-hydroxybenzyl alcohol;
4-(Hydroxymethyl)-2-methoxy-phenol
; more
Formula: C8H10O3
Class: Endogenous Metabolites Excipients/Additives/Colorants
Vanillyl alcohol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 300 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/19/2017 11:56:06 AM |
| InChI | InChI=1S/C8H10O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-4,9-10H,5H2,1H3 |
| InChI Key | ZENOXNGFMSCLLL-UHFFFAOYSA-N |
| Canonical SMILES | COC1=C(C=CC(=C1)CO)O |
| CAS | 498000 |
| Splash | |
| Other Names |
Vanillic alcohol; Vanillin alcohol; Vanillol; 3-Methoxy-4-hydroxybenzyl alcohol; 4-(Hydroxymethyl)-2-methoxy-phenol; 4-Hydroxy-3-methoxybenzenemethanol; 4-Hydroxy-3-methoxybenzyl alcohol; 4-Hydroxy-3-methoxyphenyl methanol; 4-Hydroxymethyl-2-methoxy-phenol; Benzenemethanol, 4-hydroxy-3-methoxy- |
| KEGG | C06317 |
| HMDb | HMDB32012 |
| PubChem | 62348 |
| ChEBI | CHEBI:18353 |
| ChemIDPlus | 000498000 |
| Wikipedia | Vanillyl alcohol |
| ChemSpider | 56139 |