Systematic / IUPAC Name: Ethyl 4-oxopentanoate
ID: Reference6578
Other Names:
4-Ketovaleric acid ethyl ester;
4-Oxopentanoic acid ethyl ester;
4-Oxovaleric acid ethyl ester;
Ethyl 3-acetylpropionate;
Ethyl 4-ketovalerate
; more
Formula: C7H12O3
Class: Excipients/Additives/Colorants
Ethyl levulinate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 93 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/21/2017 6:54:22 AM |
| InChI | InChI=1S/C7H12O3/c1-3-10-7(9)5-4-6(2)8/h3-5H2,1-2H3 |
| InChI Key | GMEONFUTDYJSNV-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)CCC(=O)C |
| CAS | 539888 |
| Splash | |
| Other Names |
4-Ketovaleric acid ethyl ester; 4-Oxopentanoic acid ethyl ester; 4-Oxovaleric acid ethyl ester; Ethyl 3-acetylpropionate; Ethyl 4-ketovalerate; Ethyl 4-oxovalerate; Ethyl ketovalerate; Ethyl levulate; Ethyllevulinate; Levulinic acid ethyl ester; Levulinic acid, ethyl ester; Pentanoic acid, 4-oxo-, ethyl ester |
| ChEMBL | CHEMBL3182933 |
| PubChem | 10883 |
| HMDb | HMDB40433 |
| ChemSpider | 13853514 |