Systematic / IUPAC Name: Butyl benzoate
ID: Reference6585
Other Names:
Anthrapole AZ;
Hipochem B-3-m;
Marvanol carrier BB;
n-Butyl benzoate;
Benzoic acid n-butyl ester
; more
Formula: C11H14O2
Class: Excipients/Additives/Colorants Textile Chemicals/Auxiliary/Dyes Industrial Chemicals
Butyl benzoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 713 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/25/2017 7:20:31 AM |
| InChI | InChI=1S/C11H14O2/c1-2-3-9-13-11(12)10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3 |
| InChI Key | XSIFPSYPOVKYCO-UHFFFAOYSA-N |
| Canonical SMILES | CCCCOC(=O)C1=CC=CC=C1 |
| CAS | 136607 |
| Splash | |
| Other Names |
Anthrapole AZ; Hipochem B-3-m; Marvanol carrier BB; n-Butyl benzoate; Benzoic acid n-butyl ester; Benzoic acid butyl ester; Benzoic acid, butyl ester; Butyl ester of benzoic acid |
| PubChem | 8698 |
| ChemIDPlus | 000136607 |
| ChEMBL | CHEMBL1868953 |
| ChemSpider | 8374 |