Systematic / IUPAC Name: Citral
ID: Reference6586
Other Names:
α-Citral;
β-Geranial;
(E)-Citral;
(E)-Geranial;
(E)-Neral
; more
Formula: C10H16O
Class: Endogenous Metabolites Excipients/Additives/Colorants Personal Care Products/Cosmetics Industrial Chemicals
Citral mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 978 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 4/25/2017 12:04:32 PM |
| InChI | InChI=1S/C10H16O/c1-9(2)5-4-6-10(3)7-8-11/h5,7-8H,4,6H2,1-3H3/b10-7+ |
| InChI Key | WTEVQBCEXWBHNA-JXMROGBWSA-N |
| Canonical SMILES | CC(=CCCC(=CC=O)C)C |
| CAS | 5392405 |
| Splash | |
| Other Names |
α-Citral; β-Geranial; (E)-Citral; (E)-Geranial; (E)-Neral; cis-,trans-Citral; trans-Citral; Citral a; Citral-b; Genanial; Geranal; Geranaldehyde; Geranialdehyde; Lemarome n; Lemonal; Lemsyn GB; (E)-3,7-Dimethyl-2,6-octadienal; (E)-3,7-Dimethylocta-2,6-dienal; (2E)-3,7-Dimethylocta-2,6-dienal; trans-3,7-Dimethyl-2,6-octadienal; 2,6-Dimethyloctadien-2,6-al-8; 2,6-Octadienal, 3,7-dimethyl-, (E)-; 2,6-Octadienal, 3,7-dimethyl-, (2E)-; 3,7-Dimethyl-trans-2,6-octadienal; 3,7-Dimethyl-1,2,6-octadienal; 3,7-Dimethylocta-2,6-dienal |
| Wikipedia | Citral |
| ChemIDPlus | 000141275; 005392405 |
| ChEBI | CHEBI:16980 |
| HMDb | HMDB35078; HMDB35092 |
| ChEMBL | CHEMBL1080997 |
| KEGG | C01499 |
| PubChem | 638011 |
| ChemSpider | 553578 |