Systematic / IUPAC Name: 1-(4-Methoxyphenoxy)-3-[(2-{[4-(trifluoromethyl)-2-pyrimidinyl]amino}ethyl)amino]-2-propanol
ID: Reference6609
Other Names: 2-Propanol, 1-(4-methoxyphenoxy)-3-[(2-{[4-(trifluoromethyl)-2-pyrimidinyl]amino}ethyl)amino]-
Formula: C17H21F3N4O3
1-(4-Methoxyphenoxy)-3-[(2-{[4-(trifluoromethyl)pyrimidin-2-yl]amino}ethyl)amino]propan-2-ol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/13/2017 11:34:00 AM |
| InChI | InChI=1S/C17H21F3N4O3/c1-26-13-2-4-14(5-3-13)27-11-12(25)10-21-8-9-23-16-22-7-6-15(24-16)17(18,19)20/h2-7,12,21,25H,8-11H2,1H3,(H,22,23,24) |
| InChI Key | STAUVZDEXRLSKJ-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)OCC(CNCCNC2=NC=CC(=N2)C(F)(F)F)O |
| CAS | |
| Splash | |
| Other Names | 2-Propanol, 1-(4-methoxyphenoxy)-3-[(2-{[4-(trifluoromethyl)-2-pyrimidinyl]amino}ethyl)amino]- |
| ChemSpider | 2074951 |
| ChEMBL | CHEMBL1449068 |
| PubChem | 2796075 |