Systematic / IUPAC Name: 4-Methylene-2-octyl-5-oxotetrahydro-3-furancarboxylic acid
ID: Reference6613
Other Names:
C75;
3-Furancarboxylic acid, tetrahydro-4-methylene-2-octyl-5-oxo-;
4-Methylene-2-octyl-5-oxotetrahydrofuran-3-carboxylic acid;
4-Methylidene-2-octyl-5-oxooxolane-3-carboxylic acid;
Tetrahydro-4-methylene-2R-octyl-5-oxo-3S-furancarboxylic acid
Formula: C14H22O4
(+/-)-C75 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 2 |
| No. of Spectra | 6784 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/14/2017 6:43:02 AM |
| InChI | InChI=1S/C14H22O4/c1-3-4-5-6-7-8-9-11-12(13(15)16)10(2)14(17)18-11/h11-12H,2-9H2,1H3,(H,15,16) |
| InChI Key | VCWLZDVWHQVAJU-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCC1C(C(=C)C(=O)O1)C(=O)O |
| CAS | 191282481 |
| Splash | |
| Other Names |
C75; 3-Furancarboxylic acid, tetrahydro-4-methylene-2-octyl-5-oxo-; 4-Methylene-2-octyl-5-oxotetrahydrofuran-3-carboxylic acid; 4-Methylidene-2-octyl-5-oxooxolane-3-carboxylic acid; Tetrahydro-4-methylene-2R-octyl-5-oxo-3S-furancarboxylic acid |
| PubChem | 4248455 |
| ChEBI | CHEBI:95108 |
| ChEMBL | CHEMBL477382 |
| ChemSpider | 3456585 |