Systematic / IUPAC Name: 5-Nitro-N-{2-[(2-thienylmethyl)carbamoyl]phenyl}-2-furamide
ID: Reference6617
Other Names: 2-Furancarboxamide, 5-nitro-N-(2-{[(2-thienylmethyl)amino]carbonyl}phenyl)-
Formula: C17H13N3O5S
N2-(2-{[(2-Thienylmethyl)amino]carbonyl}phenyl)-5-nitro-2-furamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 249 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/19/2017 11:02:54 AM |
| InChI | InChI=1S/C17H13N3O5S/c21-16(18-10-11-4-3-9-26-11)12-5-1-2-6-13(12)19-17(22)14-7-8-15(25-14)20(23)24/h1-9H,10H2,(H,18,21)(H,19,22) |
| InChI Key | VSEXHBGLDRHTAG-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 2-Furancarboxamide, 5-nitro-N-(2-{[(2-thienylmethyl)amino]carbonyl}phenyl)- |