Systematic / IUPAC Name: 3-{4-[(3-Phenoxybenzyl)amino]phenyl}propanoic acid
ID: Reference6626
Other Names:
GW9508;
3-[4-(3-Phenoxybenzylamino)phenyl]propanoic acid ;
3-(4-{[(3-Phenoxyphenyl)methyl]amino}phenyl)propanoic acid;
4-{[(3-Phenoxyphenyl)methyl]amino}benzenepropanoic acid ;
Benzenepropanoic acid, 4-{[(3-phenoxyphenyl)methyl]amino}-
Formula: C22H21NO3
GW 9508 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 4 |
| No. of Spectra | 5178 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 7/19/2017 10:54:00 AM |
| InChI | InChI=1S/C22H21NO3/c24-22(25)14-11-17-9-12-19(13-10-17)23-16-18-5-4-8-21(15-18)26-20-6-2-1-3-7-20/h1-10,12-13,15,23H,11,14,16H2,(H,24,25) |
| InChI Key | DGENZVKCTGIDRZ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2)CNC3=CC=C(C=C3)CCC(=O)O |
| CAS | 885101893 |
| Splash | |
| Other Names |
GW9508; 3-[4-(3-Phenoxybenzylamino)phenyl]propanoic acid ; 3-(4-{[(3-Phenoxyphenyl)methyl]amino}phenyl)propanoic acid; 4-{[(3-Phenoxyphenyl)methyl]amino}benzenepropanoic acid ; Benzenepropanoic acid, 4-{[(3-phenoxyphenyl)methyl]amino}- |
| ChemSpider | 9770191 |
| ChEMBL | CHEMBL207881 |
| PubChem | 11595431 |
| ChEBI | CHEBI:93259 |