Systematic / IUPAC Name: 2-(4,5-Dihydro-1,3-thiazol-2-ylsulfanyl)-5-nitropyridine
ID: Reference6627
Other Names: Pyridine, 2-[(4,5-dihydro-2-thiazolyl)thio]-5-nitro-
Formula: C8H7N3O2S2
2-(4,5-Dihydro-1,3-thiazol-2-ylthio)-5-nitropyridine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/19/2017 11:14:27 AM |
| InChI | InChI=1S/C8H7N3O2S2/c12-11(13)6-1-2-7(10-5-6)15-8-9-3-4-14-8/h1-2,5H,3-4H2 |
| InChI Key | XXGWDTKTHLADOK-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | Pyridine, 2-[(4,5-dihydro-2-thiazolyl)thio]-5-nitro- |