Systematic / IUPAC Name: Ethyl (2Z)-(methoxyimino)(2-{[(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)carbonyl]amino}-1,3-thiazol-4-yl)acetate
ID: Reference6630
Other Names: 4-Thiazoleacetic acid, α-(methoxyimino)-2-{[(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)carbonyl]amino}-, ethyl ester, (αZ)-
Formula: C18H18N6O4S
Ethyl 2-(methoxyimino)-2-(2-{[(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)carbonyl]amino}-1,3-thiazol-4-yl)acetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/20/2017 1:27:32 PM |
| InChI | InChI=1S/C18H18N6O4S/c1-4-28-17(26)15(23-27-3)13-10-29-18(19-13)20-16(25)14-11(2)21-24(22-14)12-8-6-5-7-9-12/h5-10H,4H2,1-3H3,(H,19,20,25)/b23-15- |
| InChI Key | LOKAEHXQLZIFAD-HAHDFKILSA-N |
| Canonical SMILES | CCOC(=O)C(=NOC)C1=CSC(=N1)NC(=O)C2=NN(N=C2C)C3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 4-Thiazoleacetic acid, α-(methoxyimino)-2-{[(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)carbonyl]amino}-, ethyl ester, (αZ)- |