Systematic / IUPAC Name: 2-[(Ethoxymethyl)(2-ethyl-6-methylphenyl)amino]-2-oxoethanesulfonic acid
ID: Reference6647
Other Names:
Acetochlor ethanesulfonic acid;
Ethanesulfonic acid,2-[(ethoxymethyl)(2-ethyl-6-methylphenyl)amino]-2-oxo-
Formula: C14H21NO5S
Acetochlor ESA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 37 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/26/2017 7:36:14 AM |
| InChI | InChI=1S/C14H21NO5S/c1-4-12-8-6-7-11(3)14(12)15(10-20-5-2)13(16)9-21(17,18)19/h6-8H,4-5,9-10H2,1-3H3,(H,17,18,19) |
| InChI Key | HXAIQOCRALNGKB-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=CC=CC(=C1N(COCC)C(=O)CS(=O)(=O)O)C |
| CAS | |
| Splash | |
| Other Names |
Acetochlor ethanesulfonic acid; Ethanesulfonic acid,2-[(ethoxymethyl)(2-ethyl-6-methylphenyl)amino]-2-oxo- |
| ChemSpider | 4932268 |
| PubChem | 6426848 |
| ChEBI | CHEBI:83452 |