Systematic / IUPAC Name: [(Ethoxymethyl)(2-ethyl-6-methylphenyl)amino](oxo)acetic acid
ID: Reference6648
Other Names:
Acetochlor OA;
Acetochlor oxanilic acid;
[(Ethoxymethyl)(2-ethyl-6-methylphenyl)amino]oxo-acetic acid;
N-(Ethoxymethyl)-N-(2-ethyl-6-methylphenyl)oxalamic acid;
Acetic acid,2-[(ethoxymethyl)(2-ethyl-6-methylphenyl)amino]-2-oxo-
Formula: C14H19NO4
Acetochlor OXA mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL |
| No. of Spectral Trees | 1 |
| No. of Spectra | 53 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/26/2017 7:41:52 AM |
| InChI | InChI=1S/C14H19NO4/c1-4-11-8-6-7-10(3)12(11)15(9-19-5-2)13(16)14(17)18/h6-8H,4-5,9H2,1-3H3,(H,17,18) |
| InChI Key | OTKTUNJJKYTOFF-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=CC=CC(=C1N(COCC)C(=O)C(=O)O)C |
| CAS | 194992444 |
| Splash | |
| Other Names |
Acetochlor OA; Acetochlor oxanilic acid; [(Ethoxymethyl)(2-ethyl-6-methylphenyl)amino]oxo-acetic acid; N-(Ethoxymethyl)-N-(2-ethyl-6-methylphenyl)oxalamic acid; Acetic acid,2-[(ethoxymethyl)(2-ethyl-6-methylphenyl)amino]-2-oxo- |
| ChEBI | CHEBI:83451 |
| PubChem | 15842091 |
| ChemSpider | 21170690 |