Systematic / IUPAC Name: Bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl) hydrogen phosphate
ID: Reference6652
Other Names:
Bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)oxyphosphinic acid;
Bis[2-(perfluorooctyl)ethyl] phosphate
Formula: C20H9F34O4P
Bisperfluorodecyl phosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 677 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 7/26/2017 8:58:11 AM |
| InChI | InChI=1S/C20H9F34O4P/c21-5(22,7(25,26)9(29,30)11(33,34)13(37,38)15(41,42)17(45,46)19(49,50)51)1-3-57-59(55,56)58-4-2-6(23,24)8(27,28)10(31,32)12(35,36)14(39,40)16(43,44)18(47,48)20(52,53)54/h1-4H2,(H,55,56) |
| InChI Key | AFWOYEYXUDHGHF-UHFFFAOYSA-N |
| Canonical SMILES | C(COP(=O)(O)OCCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| CAS | 678411 |
| Splash | |
| Other Names |
Bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)oxyphosphinic acid; Bis[2-(perfluorooctyl)ethyl] phosphate |
| ChemIDPlus | 000678411 |
| ChEBI | CHEBI:83540 |
| ChemSpider | 2288808 |
| PubChem | 3022253 |