Systematic / IUPAC Name: 3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl dihydrogen phosphate
ID: Reference6653
Other Names:
(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl)oxyphosphonic acid;
Mono[2-(perfluorohexyl)ethyl] phosphate
Formula: C8H6F13O4P
Perfluorooctyl phosphate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 3 |
| No. of Spectra | 1975 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 7/26/2017 11:30:41 AM |
| InChI | InChI=1S/C8H6F13O4P/c9-3(10,1-2-25-26(22,23)24)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1-2H2,(H2,22,23,24) |
| InChI Key | FZTRDYSPWWJCOF-UHFFFAOYSA-N |
| Canonical SMILES | C(COP(=O)(O)O)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
| CAS | 57678010 |
| Splash | |
| Other Names |
(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl)oxyphosphonic acid; Mono[2-(perfluorohexyl)ethyl] phosphate |
| PubChem | 14250578 |
| ChemSpider | 28290256 |
| ChEBI | CHEBI:83508 |