Systematic / IUPAC Name: N-(4-Chlorophenyl)-2-{2-[(3-methoxypropyl)amino]-4-oxo-4,5-dihydro-1,3-thiazol-5-yl}acetamide
ID: Reference6657
Other Names: 5-Thiazoleacetamide, N-(4-chlorophenyl)-4,5-dihydro-2-[(3-methoxypropyl)amino]-4-oxo-
Formula: C15H18ClN3O3S
N1-(4-Chlorophenyl)-2-{2-[(3-methoxypropyl)amino]-4-oxo-4,5-dihydro-1,3-thiazol-5-yl}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/26/2017 11:56:06 AM |
| InChI | InChI=1S/C15H18ClN3O3S/c1-22-8-2-7-17-15-19-14(21)12(23-15)9-13(20)18-11-5-3-10(16)4-6-11/h3-6,12H,2,7-9H2,1H3,(H,18,20)(H,17,19,21) |
| InChI Key | COCXQCWKGVMLMS-UHFFFAOYSA-N |
| Canonical SMILES | COCCCNC1=NC(=O)C(S1)CC(=O)NC2=CC=C(C=C2)Cl |
| CAS | |
| Splash | |
| Other Names | 5-Thiazoleacetamide, N-(4-chlorophenyl)-4,5-dihydro-2-[(3-methoxypropyl)amino]-4-oxo- |