Systematic / IUPAC Name: 2-Amino-1-phenyl-1-propanone
ID: Reference666
Other Names:
2-Aminopropiophenone;
2-Amino-1-phenylpropan-1-one;
1-Propanone, 2-amino-1-phenyl-;
α-Aminopropiophenone;
Propiophenone, 2-amino-
; more
Formula: C9H11NO
Class: Endogenous Metabolites Drugs of Abuse/Illegal Drugs
Cathinone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 226 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/27/2016 8:48:53 AM |
| InChI | InChI=1S/C9H11NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7H,10H2,1H3 |
| InChI Key | PUAQLLVFLMYYJJ-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)C1=CC=CC=C1)N |
| CAS | 16735196 |
| Splash | |
| Other Names |
2-Aminopropiophenone; 2-Amino-1-phenylpropan-1-one; 1-Propanone, 2-amino-1-phenyl-; α-Aminopropiophenone; Propiophenone, 2-amino-; 1-Aminoethyl phenyl ketone; 2-Amino-2-methylacetophenone; Cathinine; Abyssiniantea; Bathtabspeed; Looderstar; Ephedrane; Mulka; Cath; Chat; Knat; Quat; DL-Cathinone; African tea; Cadillac express; Wild cat; Qat |
| Wikipedia | Cathinone |
| ChemSpider | 96940 |
| PubChem | 107786 |
| ChEBI | CHEBI:59332 |
| ChEMBL | CHEMBL1124 |
| ChemIDPlus | 005265189 |