Systematic / IUPAC Name: N-[3-(1H-Imidazol-1-yl)propyl]-3-nitro-2-pyridinamine
ID: Reference6660
Other Names: 2-Pyridinamine, N-[3-(1H-imidazol-1-yl)propyl]-3-nitro-
Formula: C11H13N5O2
N2-[3-(1H-Imidazol-1-yl)propyl]-3-nitropyridin-2-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/27/2017 6:26:58 AM |
| InChI | InChI=1S/C11H13N5O2/c17-16(18)10-3-1-4-13-11(10)14-5-2-7-15-8-6-12-9-15/h1,3-4,6,8-9H,2,5,7H2,(H,13,14) |
| InChI Key | XWNJUVYCJYPQOE-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 2-Pyridinamine, N-[3-(1H-imidazol-1-yl)propyl]-3-nitro- |