Systematic / IUPAC Name: 2-[(4-Chlorophenyl)sulfanyl]-N'-[(1-methyl-1H-pyrrol-2-yl)carbonyl]ethanehydrazonamide
ID: Reference6669
Other Names: 1H-Pyrrole-2-carboxylic acid, 1-methyl-, 2-{1-amino-2-[(4-chlorophenyl)thio]ethylidene}hydrazide
Formula: C14H15ClN4OS
N'2-{2-[(4-Chlorophenyl)thio]ethanimidoyl}-1-methyl-1H-pyrrole-2-carbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/28/2017 10:15:48 AM |
| InChI | InChI=1S/C14H15ClN4OS/c1-19-8-2-3-12(19)14(20)18-17-13(16)9-21-11-6-4-10(15)5-7-11/h2-8H,9H2,1H3,(H2,16,17)(H,18,20) |
| InChI Key | SCNVAUONBAKLAH-UHFFFAOYSA-N |
| Canonical SMILES | CN1C=CC=C1C(=O)NN=C(CSC2=CC=C(C=C2)Cl)N |
| CAS | |
| Splash | |
| Other Names | 1H-Pyrrole-2-carboxylic acid, 1-methyl-, 2-{1-amino-2-[(4-chlorophenyl)thio]ethylidene}hydrazide |