Systematic / IUPAC Name: N-(2-Pyridinylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzenesulfonamide
ID: Reference6671
Other Names: Benzenesulfonamide, N-(2-pyridinylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)-
Formula: C16H14F6N2O4S
N1-(2-Pyridylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzene-1-sulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 7/28/2017 11:37:58 AM |
| InChI | InChI=1S/C16H14F6N2O4S/c17-15(18,19)9-27-12-4-5-13(28-10-16(20,21)22)14(7-12)29(25,26)24-8-11-3-1-2-6-23-11/h1-7,24H,8-10H2 |
| InChI Key | USDLJGJXDJXNHC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=NC(=C1)CNS(=O)(=O)C2=C(C=CC(=C2)OCC(F)(F)F)OCC(F)(F)F |
| CAS | |
| Splash | |
| Other Names | Benzenesulfonamide, N-(2-pyridinylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)- |
| PubChem | 2806032 |
| ChemSpider | 2084554 |
| ChEMBL | CHEMBL1607317 |