Systematic / IUPAC Name: Methyl hexadecanoate
ID: Reference6685
Other Names:
Metholene 2216;
Radia 7120;
Uniphat A60;
n-Hexadecanoic acid methyl ester;
Hexadecanoic acid methyl ester
; more
Formula: C17H34O2
Methyl palmitate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1774 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/7/2017 12:26:41 PM |
| InChI | InChI=1S/C17H34O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(18)19-2/h3-16H2,1-2H3 |
| InChI Key | FLIACVVOZYBSBS-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCCCCCCCCCCCC(=O)OC |
| CAS | 112390 |
| Splash | |
| Other Names |
Metholene 2216; Radia 7120; Uniphat A60; n-Hexadecanoic acid methyl ester; Hexadecanoic acid methyl ester; Hexadecanoic acid, methyl ester; Methyl n-hexadecanoate; Palmitic acid methyl ester; MP |
| ChemIDPlus | 000112390 |
| PubChem | 8181 |
| ChEBI | CHEBI:69187 |
| ChEMBL | CHEMBL335125 |
| KEGG | C16995 |
| HMDb | HMDB61859 |
| ChemSpider | 7889 |