Systematic / IUPAC Name: N-(4-Methoxybenzyl)-4-methyl-N-[(1-methyl-1H-pyrrol-2-yl)methyl]benzenesulfonamide
ID: Reference6690
Other Names:
N-[(4-Methoxyphenyl)methyl]-4-methyl-N-[(1-methyl-1H-pyrrol-2-yl)methyl]benzene-1-sulfonamide;
Benzenesulfonamide, N-[(4-methoxyphenyl)methyl]-4-methyl-N-[(1-methyl-1H-pyrrol-2-yl)methyl]-
Formula: C21H24N2O3S
N-(4-Methoxybenzyl)-4-methyl-N-[(1-methyl-1H-pyrrol-2-yl)methyl]benzenesulfonamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/8/2017 10:39:02 AM |
| InChI | InChI=1S/C21H24N2O3S/c1-17-6-12-21(13-7-17)27(24,25)23(16-19-5-4-14-22(19)2)15-18-8-10-20(26-3)11-9-18/h4-14H,15-16H2,1-3H3 |
| InChI Key | DVFOCCQHCXEVST-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CC2=CC=C(C=C2)OC)CC3=CC=CN3C |
| CAS | |
| Splash | |
| Other Names |
N-[(4-Methoxyphenyl)methyl]-4-methyl-N-[(1-methyl-1H-pyrrol-2-yl)methyl]benzene-1-sulfonamide; Benzenesulfonamide, N-[(4-methoxyphenyl)methyl]-4-methyl-N-[(1-methyl-1H-pyrrol-2-yl)methyl]- |
| ChEMBL | CHEMBL1533268 |
| ChemSpider | 2088209 |
| PubChem | 2809788 |