Systematic / IUPAC Name: 3-[(Methoxycarbonyl)amino]phenyl (3-methylphenyl)carbamate
ID: Reference67
Other Names:
3-((Methoxycarbonyl)amino)phenyl m-tolylcarbamate;
[3-(Methoxycarbonylamino)phenyl] N-(3-methylphenyl)carbamate;
Methyl 3-(3-methylcarbaniloyloxy)carbanilate;
Methyl 3-(m-tolylcarbamoyloxy)phenylcarbamate;
3-(Carbomethoxyamino)phenyl 3-methylcarbanilate
; more
Formula: C16H16N2O4
Class: Pesticides/Herbicides
Phenmedipham mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | LTQ Orbitrap XL; Orbitrap ID-X with ETD_Cal Gateshead |
| No. of Spectral Trees | 2 |
| No. of Spectra | 901 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | ESI; NSI |
| Analyzers | FT |
| Last Modification | 1/15/2015 12:57:34 PM |
| InChI | InChI=1S/C16H16N2O4/c1-11-5-3-6-12(9-11)18-16(20)22-14-8-4-7-13(10-14)17-15(19)21-2/h3-10H,1-2H3,(H,17,19)(H,18,20) |
| InChI Key | IDOWTHOLJBTAFI-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=CC=C1)NC(=O)OC2=CC=CC(=C2)NC(=O)OC |
| CAS | 13684634 |
| Splash | |
| Other Names |
3-((Methoxycarbonyl)amino)phenyl m-tolylcarbamate; [3-(Methoxycarbonylamino)phenyl] N-(3-methylphenyl)carbamate; Methyl 3-(3-methylcarbaniloyloxy)carbanilate; Methyl 3-(m-tolylcarbamoyloxy)phenylcarbamate; 3-(Carbomethoxyamino)phenyl 3-methylcarbanilate; Carbamic acid, (3-methylphenyl), 3-[(methoxycarbonyl)amino]phenyl ester; Methyl-3-hydroxycarbanilate-3-methylcarbanilate; Methyl N-(3-(N-(3-methylphenyl)carbamoyloxy)phenyl)carbamate; Carbanilic acid, m-hydroxy, methyl ester, m-methylcarbanilate; 3-(Methylphenyl)carbamic acid 3-((methoxycarbonyl)amino)phenyl ester; Carbamic acid, (3-methylphenyl), 3-((methoxycarbonyl)amino)phenyl ester; N-[3-[(3-Methylanilino)-oxomethoxy]phenyl]carbamic acid methyl ester; Betanal; Kemifam; Spin-aid; Synbetan P; Schering 4072; Morton EP 452 |
| ChemIDPlus | 013684634; 051279971 |
| KEGG | C18420 |
| ChemSpider | 23134 |
| Wikipedia | Phenmedipham (DE) |
| PubChem | 24744 |
| ChEMBL | CHEMBL1079421 |