Systematic / IUPAC Name: 5-[(1,3-Dimethyl-1H-pyrazol-5-yl)amino]-5-oxopentanoic acid
ID: Reference6708
Other Names: Pentanoic acid, 5-[(1,3-dimethyl-1H-pyrazol-5-yl)amino]-5-oxo-
Formula: C10H15N3O3
5-[(1,3-Dimethyl-1H-pyrazol-5-yl)amino]-5-oxopentanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/14/2017 7:13:16 AM |
| InChI | InChI=1S/C10H15N3O3/c1-7-6-8(13(2)12-7)11-9(14)4-3-5-10(15)16/h6H,3-5H2,1-2H3,(H,11,14)(H,15,16) |
| InChI Key | DMSAWNVRFFFJRM-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NN(C(=C1)NC(=O)CCCC(=O)O)C |
| CAS | |
| Splash | |
| Other Names | Pentanoic acid, 5-[(1,3-dimethyl-1H-pyrazol-5-yl)amino]-5-oxo- |