Systematic / IUPAC Name: 1-(2,6-Dibromo-4-isopropylphenyl)-3-(4-ethyl-2-pyridinyl)urea
ID: Reference6709
Other Names: Urea, N-[2,6-dibromo-4-(1-methylethyl)phenyl]-N'-(4-ethyl-2-pyridinyl)-
Formula: C17H19Br2N3O
N-(2,6-Dibromo-4-isopropylphenyl)-N'-(4-ethyl-2-pyridinyl)urea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/14/2017 7:18:25 AM |
| InChI | InChI=1S/C17H19Br2N3O/c1-4-11-5-6-20-15(7-11)21-17(23)22-16-13(18)8-12(10(2)3)9-14(16)19/h5-10H,4H2,1-3H3,(H2,20,21,22,23) |
| InChI Key | OTKHDGNNAXWXIR-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=CC(=NC=C1)NC(=O)NC2=C(C=C(C=C2Br)C(C)C)Br |
| CAS | |
| Splash | |
| Other Names | Urea, N-[2,6-dibromo-4-(1-methylethyl)phenyl]-N'-(4-ethyl-2-pyridinyl)- |