Systematic / IUPAC Name: (9E)-9-Nitro-9-octadecenoic acid
ID: Reference6717
Other Names:
(E)-9-Nitrooctadec-9-enoic acid;
(9E)-9-Nitrooctadec-9-enoic acid;
(9E)-9-Nitrooctadecenoic acid;
9-Nitro oleic acid;
9-Nitro-9E-octadecenoic acid
Formula: C18H33NO4
9-Nitrooleate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS ; Orbitrap Fusion Lumos with ETD LBP |
| No. of Spectral Trees | 5 |
| No. of Spectra | 8954 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/14/2017 6:55:02 AM |
| InChI | InChI=1S/C18H33NO4/c1-2-3-4-5-6-8-11-14-17(19(22)23)15-12-9-7-10-13-16-18(20)21/h14H,2-13,15-16H2,1H3,(H,20,21)/b17-14+ |
| InChI Key | CQOAKBVRRVHWKV-SAPNQHFASA-N |
| Canonical SMILES | |
| CAS | 875685442 |
| Splash | |
| Other Names |
(E)-9-Nitrooctadec-9-enoic acid; (9E)-9-Nitrooctadec-9-enoic acid; (9E)-9-Nitrooctadecenoic acid; 9-Nitro oleic acid; 9-Nitro-9E-octadecenoic acid |
| ChEBI | CHEBI:86329 |
| ChEMBL | CHEMBL550762 |
| PubChem | 11645581 |
| ChemSpider | 9820320 |