Systematic / IUPAC Name: 4-(9H-Fluoren-9-yl)-N-[2-(2-thienyl)ethyl]-1-piperazinecarboxamide
ID: Reference6720
Other Names: 1-Piperazinecarboxamide, 4-(9H-fluoren-9-yl)-N-[2-(2-thienyl)ethyl]-
Formula: C24H25N3OS
4-(9H-Fluoren-9-yl)-N-[2-(2-thienyl)ethyl]tetrahydro-1(2H)-pyrazinecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/14/2017 1:03:41 PM |
| InChI | InChI=1S/C24H25N3OS/c28-24(25-12-11-18-6-5-17-29-18)27-15-13-26(14-16-27)23-21-9-3-1-7-19(21)20-8-2-4-10-22(20)23/h1-10,17,23H,11-16H2,(H,25,28) |
| InChI Key | LABRXLDHXWQFPJ-UHFFFAOYSA-N |
| Canonical SMILES | C1CN(CCN1C2C3=CC=CC=C3C4=CC=CC=C24)C(=O)NCCC5=CC=CS5 |
| CAS | |
| Splash | |
| Other Names | 1-Piperazinecarboxamide, 4-(9H-fluoren-9-yl)-N-[2-(2-thienyl)ethyl]- |