Systematic / IUPAC Name: Methyl 5-[(4-acetamidophenoxy)methyl]-2-furoate
ID: Reference6722
Other Names: Methyl 5-(4-acetamidophenoxymethyl)furan-2-carboxylate
Formula: C15H15NO5
Methyl 5-{[4-(acetylamino)phenoxy]methyl}-2-furoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/14/2017 1:12:56 PM |
| InChI | InChI=1S/C15H15NO5/c1-10(17)16-11-3-5-12(6-4-11)20-9-13-7-8-14(21-13)15(18)19-2/h3-8H,9H2,1-2H3,(H,16,17) |
| InChI Key | HXMASFOMCDHEIE-UHFFFAOYSA-N |
| Canonical SMILES | CC(=O)NC1=CC=C(C=C1)OCC2=CC=C(O2)C(=O)OC |
| CAS | |
| Splash | |
| Other Names | Methyl 5-(4-acetamidophenoxymethyl)furan-2-carboxylate |
| ChEMBL | CHEMBL1525428 |
| PubChem | 2814720 |
| ChemSpider | 2093105 |