Systematic / IUPAC Name: Ethyl 4-{[(3-chloro-1-benzothiophen-2-yl)carbonyl]amino}-1-piperidinecarboxylate
ID: Reference6731
Other Names:
1-Piperidinecarboxylic acid, 4-{[(3-chlorobenzo[b]thien-2-yl)carbonyl]amino}-, ethyl ester ;
Ethyl 4-(3-chloro-1-benzothiophene-2-amido)piperidine-1-carboxylate
Formula: C17H19ClN2O3S
Ethyl 4-{[(3-chloro-1-benzothiophen-2-yl)carbonyl]amino}tetrahydro-1(2H)-pyridinecarboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/16/2017 7:25:06 AM |
| InChI | InChI=1S/C17H19ClN2O3S/c1-2-23-17(22)20-9-7-11(8-10-20)19-16(21)15-14(18)12-5-3-4-6-13(12)24-15/h3-6,11H,2,7-10H2,1H3,(H,19,21) |
| InChI Key | LWUVXGWCNCABLY-UHFFFAOYSA-N |
| Canonical SMILES | CCOC(=O)N1CCC(CC1)NC(=O)C2=C(C3=CC=CC=C3S2)Cl |
| CAS | |
| Splash | |
| Other Names |
1-Piperidinecarboxylic acid, 4-{[(3-chlorobenzo[b]thien-2-yl)carbonyl]amino}-, ethyl ester ; Ethyl 4-(3-chloro-1-benzothiophene-2-amido)piperidine-1-carboxylate |