Systematic / IUPAC Name: N'-[(3-Methoxyphenyl)acetyl]-2,2'-bithiophene-5-carbohydrazide
ID: Reference6733
Other Names: [2,2'-Bithiophene]-5-carboxylic acid, 2-[2-(3-methoxyphenyl)acetyl]hydrazide
Formula: C18H16N2O3S2
N'-[2-(3-Methoxyphenyl)acetyl]-5-(2-thienyl)-2-thiophenecarbohydrazide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 91 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/16/2017 12:55:36 PM |
| InChI | InChI=1S/C18H16N2O3S2/c1-23-13-5-2-4-12(10-13)11-17(21)19-20-18(22)16-8-7-15(25-16)14-6-3-9-24-14/h2-10H,11H2,1H3,(H,19,21)(H,20,22) |
| InChI Key | GPIMBDIUUDWERD-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC(=C1)CC(=O)NNC(=O)C2=CC=C(S2)C3=CC=CS3 |
| CAS | |
| Splash | |
| Other Names | [2,2'-Bithiophene]-5-carboxylic acid, 2-[2-(3-methoxyphenyl)acetyl]hydrazide |