Systematic / IUPAC Name: tert-Butyl N-(1-amino-4-methyl-1-oxopentan-2-yl)carbamate
ID: Reference6752
Other Names:
N2-{[(2-methyl-2-propanyl)oxy]carbonyl}leucinamide ;
tert-Butyl N-(1-carbamoyl-3-methylbutyl)carbamate
Formula: C11H22N2O3
tert-Butyl N-[1-(aminocarbonyl)-3-methylbutyl]carbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/28/2017 8:29:28 AM |
| InChI | InChI=1S/C11H22N2O3/c1-7(2)6-8(9(12)14)13-10(15)16-11(3,4)5/h7-8H,6H2,1-5H3,(H2,12,14)(H,13,15) |
| InChI Key | LJPDJTPZNJKXPW-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)CC(C(=O)N)NC(=O)OC(C)(C)C |
| CAS | |
| Splash | |
| Other Names |
N2-{[(2-methyl-2-propanyl)oxy]carbonyl}leucinamide ; tert-Butyl N-(1-carbamoyl-3-methylbutyl)carbamate |
| ChemSpider | 2096434 |
| PubChem | 2818159 |
| ChEMBL | CHEMBL3436578 |