Systematic / IUPAC Name: 3,7-Dimethyl-3,7-dihydro-1H-purine-2,6-dione
ID: Reference676
Other Names:
3,7-Dimethylxanthine;
Xanthine, 3,7-dimethyl-;
1H-Purine-2,6-dione, 3,7-dihydro-3,7-dimethyl-;
3,7-Dimethylpurine-2,6-dione;
2,6-Dihydroxy-3,7-dimethylpurine
; more
Formula: C7H8N4O2
Class: Endogenous Metabolites
Theobromine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite; Q Exactive Orbitrap |
| No. of Spectral Trees | 3 |
| No. of Spectra | 334 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI; APCI |
| Analyzers | FT |
| Last Modification | 2/19/2015 12:51:00 PM |
| InChI | InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2/h3H,1-2H3,(H,9,12,13) |
| InChI Key | YAPQBXQYLJRXSA-UHFFFAOYSA-N |
| Canonical SMILES | CN1C=NC2=C1C(=O)NC(=O)N2C |
| CAS | 83670 |
| Splash | |
| Other Names |
3,7-Dimethylxanthine; Xanthine, 3,7-dimethyl-; 1H-Purine-2,6-dione, 3,7-dihydro-3,7-dimethyl-; 3,7-Dimethylpurine-2,6-dione; 2,6-Dihydroxy-3,7-dimethylpurine; 3,7-Dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione; Diurobromine; Teobromin; Theosalvose; Santheose; Theostene; Thesal; Thesodate |
| ChEBI | CHEBI:28946 |
| HMDb | HMDB02825 |
| ChemIDPlus | 000083670; 006767733; 008048315; 016484858; 001010599; 017186957; XH2395000 |
| ChemSpider | 5236 |
| ChEMBL | CHEMBL1114 |
| PubChem | 5429 |
| Wikipedia | Theobromine |
| KEGG | C07480 |