Systematic / IUPAC Name: 4-Hydroxy-1,5,6-trimethyl-N-phenyl-1H-thieno[2,3-c][1,2]thiazine-3-carboxamide 2,2-dioxide
ID: Reference6760
Other Names: 1H-Thieno[2,3-c][1,2]thiazine-3-carboxamide, 4-hydroxy-1,5,6-trimethyl-N-phenyl, 2,2-dioxide
Formula: C16H16N2O4S2
N3-Phenyl-4-hydroxy-1,5,6-trimethyl-2,2-dioxo-1,2-dihydro-2λ6-thieno[2,3-c][1,2]thiazine-3-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 184 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/28/2017 8:57:59 AM |
| InChI | InChI=1S/C16H16N2O4S2/c1-9-10(2)23-16-12(9)13(19)14(24(21,22)18(16)3)15(20)17-11-7-5-4-6-8-11/h4-8,19H,1-3H3,(H,17,20) |
| InChI Key | XXAWYHRGGJFCLJ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(SC2=C1C(=C(S(=O)(=O)N2C)C(=O)NC3=CC=CC=C3)O)C |
| CAS | |
| Splash | |
| Other Names | 1H-Thieno[2,3-c][1,2]thiazine-3-carboxamide, 4-hydroxy-1,5,6-trimethyl-N-phenyl, 2,2-dioxide |
| PubChem | 54687621 |
| ChemSpider | 18012862 |
| ChEMBL | CHEMBL1461051 |