Systematic / IUPAC Name: N-[5-(Phenylethynyl)-3-pyridinyl]-4-morpholinecarboxamide
ID: Reference6767
Other Names: 4-Morpholinecarboxamide, N-[5-(2-phenylethynyl)-3-pyridinyl]-
Formula: C18H17N3O2
N4-[5-(2-Phenyleth-1-ynyl)-3-pyridyl]morpholine-4-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 242 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/28/2017 9:57:14 AM |
| InChI | InChI=1S/C18H17N3O2/c22-18(21-8-10-23-11-9-21)20-17-12-16(13-19-14-17)7-6-15-4-2-1-3-5-15/h1-5,12-14H,8-11H2,(H,20,22) |
| InChI Key | YEMQENHBJPTXQC-UHFFFAOYSA-N |
| Canonical SMILES | C1COCCN1C(=O)NC2=CN=CC(=C2)C#CC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | 4-Morpholinecarboxamide, N-[5-(2-phenylethynyl)-3-pyridinyl]- |