Systematic / IUPAC Name: 2-{[4-(2-Furyl)-2-pyrimidinyl]sulfanyl}-N-(4-isopropylphenyl)acetamide
ID: Reference6773
Other Names: Acetamide, 2-{[4-(2-furanyl)-2-pyrimidinyl]thio}-N-[4-(1-methylethyl)phenyl]-
Formula: C19H19N3O2S
N1-(4-Isopropylphenyl)-2-{[4-(2-furyl)pyrimidin-2-yl]thio}acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 8/28/2017 10:05:30 AM |
| InChI | InChI=1S/C19H19N3O2S/c1-13(2)14-5-7-15(8-6-14)21-18(23)12-25-19-20-10-9-16(22-19)17-4-3-11-24-17/h3-11,13H,12H2,1-2H3,(H,21,23) |
| InChI Key | ASINDISBLBEUNG-UHFFFAOYSA-N |
| Canonical SMILES | CC(C)C1=CC=C(C=C1)NC(=O)CSC2=NC=CC(=N2)C3=CC=CO3 |
| CAS | |
| Splash | |
| Other Names | Acetamide, 2-{[4-(2-furanyl)-2-pyrimidinyl]thio}-N-[4-(1-methylethyl)phenyl]- |