Systematic / IUPAC Name: 3,3-Bis(methylsulfanyl)-2-(2-pyridinyl)acrylonitrile
ID: Reference6784
Other Names: 2-Pyridineacetonitrile, α-[bis(methylthio)methylene]-
Formula: C10H10N2S2
3,3-Bis(methylthio)-2-(2-pyridyl)acrylonitrile mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/5/2017 12:34:44 PM |
| InChI | InChI=1S/C10H10N2S2/c1-13-10(14-2)8(7-11)9-5-3-4-6-12-9/h3-6H,1-2H3 |
| InChI Key | WMDXYHIKZCHDMX-UHFFFAOYSA-N |
| Canonical SMILES | CSC(=C(C#N)C1=CC=CC=N1)SC |
| CAS | |
| Splash | |
| Other Names | 2-Pyridineacetonitrile, α-[bis(methylthio)methylene]- |