Systematic / IUPAC Name: 1-[2-(Benzylamino)ethyl]-3-mesitylthiourea
ID: Reference6789
Other Names: Thiourea, N-{2-[(phenylmethyl)amino]ethyl}-N'-(2,4,6-trimethylphenyl)-
Formula: C19H25N3S
N-[2-(Benzylamino)ethyl]-N'-mesitylthiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 164 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/6/2017 7:22:09 AM |
| InChI | InChI=1S/C19H25N3S/c1-14-11-15(2)18(16(3)12-14)22-19(23)21-10-9-20-13-17-7-5-4-6-8-17/h4-8,11-12,20H,9-10,13H2,1-3H3,(H2,21,22,23) |
| InChI Key | CSYJNKKVMXLDHG-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C(=C1)C)NC(=S)NCCNCC2=CC=CC=C2)C |
| CAS | |
| Splash | |
| Other Names | Thiourea, N-{2-[(phenylmethyl)amino]ethyl}-N'-(2,4,6-trimethylphenyl)- |