Systematic / IUPAC Name: 1-(3-Methoxypropyl)-3-[3-(methylsulfanyl)phenyl]thiourea
ID: Reference6791
Other Names:
N-(3-Methoxypropyl)-N'-[3-(methylthio)phenyl]thiourea ;
Thiourea, N-(3-methoxypropyl)-N'-[3-(methylthio)phenyl]-
Formula: C12H18N2OS2
N-(3-Methoxypropyl)-N'-[3-(methylthio)phenyl]thiourea mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 238 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/6/2017 9:20:16 AM |
| InChI | InChI=1S/C12H18N2OS2/c1-15-8-4-7-13-12(16)14-10-5-3-6-11(9-10)17-2/h3,5-6,9H,4,7-8H2,1-2H3,(H2,13,14,16) |
| InChI Key | ZMRKWWGSTJDZNQ-UHFFFAOYSA-N |
| Canonical SMILES | COCCCNC(=S)NC1=CC(=CC=C1)SC |
| CAS | |
| Splash | |
| Other Names |
N-(3-Methoxypropyl)-N'-[3-(methylthio)phenyl]thiourea ; Thiourea, N-(3-methoxypropyl)-N'-[3-(methylthio)phenyl]- |
| ChEMBL | CHEMBL1558995 |
| ChemSpider | 2007243 |
| PubChem | 2725136 |