Systematic / IUPAC Name: N-(2,4-Dichlorophenyl)-N-ethyl-6-methoxy-4-(trifluoromethyl)nicotinamide
ID: Reference6796
Other Names: 3-Pyridinecarboxamide, N-(2,4-dichlorophenyl)-N-ethyl-6-methoxy-4-(trifluoromethyl)-
Formula: C16H13Cl2F3N2O2
N-(2,4-Dichlorophenyl)-N-ethyl-6-methoxy-4-(trifluoromethyl)nicotinamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/8/2017 12:06:31 PM |
| InChI | InChI=1S/C16H13Cl2F3N2O2/c1-3-23(13-5-4-9(17)6-12(13)18)15(24)10-8-22-14(25-2)7-11(10)16(19,20)21/h4-8H,3H2,1-2H3 |
| InChI Key | OYMNUNVNKUUXRQ-UHFFFAOYSA-N |
| Canonical SMILES | CCN(C1=C(C=C(C=C1)Cl)Cl)C(=O)C2=CN=C(C=C2C(F)(F)F)OC |
| CAS | |
| Splash | |
| Other Names | 3-Pyridinecarboxamide, N-(2,4-dichlorophenyl)-N-ethyl-6-methoxy-4-(trifluoromethyl)- |
| ChemSpider | 2009061 |
| ChEMBL | CHEMBL1526936 |
| PubChem | 2727009 |