Systematic / IUPAC Name: N-[5-({2-[(4-Butyl-2-methylphenyl)amino]-2-oxoethyl}sulfanyl)-1,3,4-thiadiazol-2-yl]-2-thiophenecarboxamide
ID: Reference6798
Other Names: 2-Thiophenecarboxamide, N-[5-({2-[(4-butyl-2-methylphenyl)amino]-2-oxoethyl}thio)-1,3,4-thiadiazol-2-yl]-
Formula: C20H22N4O2S3
N-2-(5-{[2-(4-Butyl-2-methylanilino)-2-oxoethyl]thio}-1,3,4-thiadiazol-2-yl)thiophene-2-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/8/2017 12:10:14 PM |
| InChI | InChI=1S/C20H22N4O2S3/c1-3-4-6-14-8-9-15(13(2)11-14)21-17(25)12-28-20-24-23-19(29-20)22-18(26)16-7-5-10-27-16/h5,7-11H,3-4,6,12H2,1-2H3,(H,21,25)(H,22,23,26) |
| InChI Key | UUJNYHVUKPKJEW-UHFFFAOYSA-N |
| Canonical SMILES | CCCCC1=CC(=C(C=C1)NC(=O)CSC2=NN=C(S2)NC(=O)C3=CC=CS3)C |
| CAS | |
| Splash | |
| Other Names | 2-Thiophenecarboxamide, N-[5-({2-[(4-butyl-2-methylphenyl)amino]-2-oxoethyl}thio)-1,3,4-thiadiazol-2-yl]- |