Systematic / IUPAC Name: Ethyl 2-[(E)-(4,5-dibromo-2-hydroxybenzylidene)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate
ID: Reference6806
Other Names: Benzo[b]thiophene-3-carboxylic acid, 2-{[(1E)-(4,5-dibromo-2-hydroxyphenyl)methylene]amino}-4,5,6,7-tetrahydro-, ethyl ester
Formula: C18H17Br2NO3S
Ethyl 2-{[(4,5-dibromo-2-hydroxyphenyl)methylene]amino}-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 119 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 9/11/2017 2:17:10 PM |
| InChI | InChI=1S/C18H17Br2NO3S/c1-2-24-18(23)16-11-5-3-4-6-15(11)25-17(16)21-9-10-7-12(19)13(20)8-14(10)22/h7-9,22H,2-6H2,1H3/b21-9+ |
| InChI Key | GGBRXCNVQHIVCL-ZVBGSRNCSA-N |
| Canonical SMILES | CCOC(=O)c1c2c(sc1/N=C/c3cc(c(cc3O)Br)Br)CCCC2 |
| CAS | |
| Splash | |
| Other Names | Benzo[b]thiophene-3-carboxylic acid, 2-{[(1E)-(4,5-dibromo-2-hydroxyphenyl)methylene]amino}-4,5,6,7-tetrahydro-, ethyl ester |